C56H69B2NO4 — CID 171428696
9-[8,14-bis(4-tert-butylphenyl)-11-(8-carboxyoctyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-4-yl]nonanoic acid (PubChem CID 171428696) has the molecular formula C56H69B2NO4 and a molecular weight of 841.79 g/mol. Its IUPAC name is 9-[8,14-bis(4-tert-butylphenyl)-11-(8-carboxyoctyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-4-yl]nonanoic acid.
| Compound Name | 9-[8,14-bis(4-tert-butylphenyl)-11-(8-carboxyoctyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-4-yl]nonanoic acid |
|---|---|
| PubChem CID | 171428696 |
| Molecular Formula | C56H69B2NO4 |
| Molecular Weight | 841.79 g/mol |
| Exact Mass | 841.54 |
| IUPAC Name | 9-[8,14-bis(4-tert-butylphenyl)-11-(8-carboxyoctyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-4-yl]nonanoic acid |
| SMILES | CC(C)(C)c1ccc(B2c3ccccc3N3c4cc(CCCCCCCCC(=O)O)ccc4B(c4ccc(C(C)(C)C)cc4)c4cc(CCCCCCCCC(=O)O)cc2c43)cc1 |
| InChI | InChI=1S/C56H69B2NO4/c1-55(2,3)42-28-32-44(33-29-42)57-46-23-19-20-24-50(46)59-51-39-40(21-15-11-7-9-13-17-25-52(60)61)27-36-47(51)58(45-34-30-43(31-35-45)56(4,5)6)49-38-41(37-48(57)54(49)59)22-16-12-8-10-14-18-26-53(62)63/h19-20,23-24,27-39H,7-18,21-22,25-26H2,1-6H3,(H,60,61)(H,62,63) |
| InChIKey | ALBXIRWFWZHVRB-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.79 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|