C29H49NO3 — CID 171428773
(4Z,7Z,10Z)-1-[3-hydroxypropyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol (PubChem CID 171428773) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is (4Z,7Z,10Z)-1-[3-hydroxypropyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol.
| Compound Name | (4Z,7Z,10Z)-1-[3-hydroxypropyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol |
|---|---|
| PubChem CID | 171428773 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | (4Z,7Z,10Z)-1-[3-hydroxypropyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(O)CN(CCCO)CC(O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C29H49NO3/c1-3-5-7-9-11-13-15-17-19-22-28(32)26-30(24-21-25-31)27-29(33)23-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,28-29,31-33H,3-4,9-10,15-16,21-27H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | HTWRCWWFLVSWHE-YTWBPVBXSA-N |
| XLogP | 5.89 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|