C20H34N4 — CID 171429399
1-tert-butyl-4-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]piperazine (PubChem CID 171429399) has the molecular formula C20H34N4 and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-tert-butyl-4-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 171429399 |
| Molecular Formula | C20H34N4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 1-tert-butyl-4-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]piperazine |
| SMILES | Cc1ccc(N2CCC(CN3CCN(C(C)(C)C)CC3)CC2)nc1 |
| InChI | InChI=1S/C20H34N4/c1-17-5-6-19(21-15-17)23-9-7-18(8-10-23)16-22-11-13-24(14-12-22)20(2,3)4/h5-6,15,18H,7-14,16H2,1-4H3 |
| InChIKey | FRKCPGSHNSSBAU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |