About 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline
1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline (PubChem CID 171430158) has the molecular formula C16H18ClN
and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline.
Molecular Properties
| Compound Name | 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline |
| PubChem CID | 171430158 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline |
| SMILES | CC1(C)CCC(c2ccc3c(Cl)nccc3c2)C1 |
| InChI | InChI=1S/C16H18ClN/c1-16(2)7-5-13(10-16)11-3-4-14-12(9-11)6-8-18-15(14)17/h3-4,6,8-9,13H,5,7,10H2,1-2H3 |
| InChIKey | MNPYHPRDSOTQRI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline?
The IUPAC name of 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline (CID 171430158) is 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline.
What is the SMILES notation for 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline?
The canonical SMILES for 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline is CC1(C)CCC(c2ccc3c(Cl)nccc3c2)C1.
What is the InChIKey of 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline?
The InChIKey is MNPYHPRDSOTQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN/c1-16(2)7-5-13(10-16)11-3-4-14-12(9-11)6-8-18-15(14)17/h3-4,6,8-9,13H,5,7,10H2,1-2H3.
What are the key properties of 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline?
1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline has a molecular weight of 259.78 g/mol, XLogP of 5.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6-(3,3-dimethylcyclopentyl)isoquinoline is sourced from PubChem (CID 171430158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).