About 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole
1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole (PubChem CID 171430322) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole.
Molecular Properties
| Compound Name | 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole |
| PubChem CID | 171430322 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole |
| SMILES | CC(C)[C@@H]1CCC[C@H](Cn2cccn2)C1 |
| InChI | InChI=1S/C13H22N2/c1-11(2)13-6-3-5-12(9-13)10-15-8-4-7-14-15/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | SVEZRADRHCYRDN-QWHCGFSZSA-N |
| XLogP | 3.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole?
The IUPAC name of 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole (CID 171430322) is 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole.
What is the SMILES notation for 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole?
The canonical SMILES for 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole is CC(C)[C@@H]1CCC[C@H](Cn2cccn2)C1.
What is the InChIKey of 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole?
The InChIKey is SVEZRADRHCYRDN-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H22N2/c1-11(2)13-6-3-5-12(9-13)10-15-8-4-7-14-15/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole?
1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole has a molecular weight of 206.33 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,3R)-3-propan-2-ylcyclohexyl]methyl]pyrazole is sourced from PubChem (CID 171430322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).