C32H38N8O2S — CID 171430501
3-[6-[[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N-methyl-N-(oxan-3-ylmethyl)benzamide (PubChem CID 171430501) has the molecular formula C32H38N8O2S and a molecular weight of 598.78 g/mol. Its IUPAC name is 3-[6-[[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N-methyl-N-(oxan-3-ylmethyl)benzamide.
| Compound Name | 3-[6-[[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N-methyl-N-(oxan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 171430501 |
| Molecular Formula | C32H38N8O2S |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 3-[6-[[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N-methyl-N-(oxan-3-ylmethyl)benzamide |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2c1nc(C)cc(Nc2cc3nc(-c4cccc(C(=O)N(C)CC5CCCOC5)c4)sc3cn2)n1 |
| InChI | InChI=1S/C32H38N8O2S/c1-4-39-17-25-13-24(39)18-40(25)32-34-20(2)11-29(37-32)36-28-14-26-27(15-33-28)43-30(35-26)22-8-5-9-23(12-22)31(41)38(3)16-21-7-6-10-42-19-21/h5,8-9,11-12,14-15,21,24-25H,4,6-7,10,13,16-19H2,1-3H3,(H,33,34,36,37)/t21?,24-,25-/m0/s1 |
| InChIKey | VFJAUXMRORZFMR-MHKYCTGGSA-N |
| XLogP | 4.98 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |