C55H33N3OS — CID 171430819
2-(3,5-diphenylphenyl)-4-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzothiol-7-yl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 171430819) has the molecular formula C55H33N3OS and a molecular weight of 793.01 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzothiol-7-yl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzothiol-7-yl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171430819 |
| Molecular Formula | C55H33N3OS |
| Molecular Weight | 793.01 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzothiol-7-yl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3ccc4c(c3)oc3cccc(-c5ccccc5)c34)n2)c2c(sc3c4c([2H])c([2H])c([2H])c([2H])c4c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C55H33N3OS/c1-4-14-34(15-5-1)39-30-40(35-16-6-2-7-17-35)32-41(31-39)54-56-53(38-27-28-44-48(33-38)59-47-24-12-22-42(50(44)47)36-18-8-3-9-19-36)57-55(58-54)46-23-13-25-49-51(46)45-29-26-37-20-10-11-21-43(37)52(45)60-49/h1-33H/i10D,11D,13D,20D,21D,23D,25D,26D,29D |
| InChIKey | JGCIWXJGFHQWEM-WXXRWHEGSA-N |
| XLogP | 15.29 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.01 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |