C20H17N3O — CID 171431136
3,4-dihydro-2H-quinolin-1-yl-(6-phenylpyrazin-2-yl)methanone (PubChem CID 171431136) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-(6-phenylpyrazin-2-yl)methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-(6-phenylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 171431136 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-(6-phenylpyrazin-2-yl)methanone |
| SMILES | O=C(c1cncc(-c2ccccc2)n1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H17N3O/c24-20(23-12-6-10-16-9-4-5-11-19(16)23)18-14-21-13-17(22-18)15-7-2-1-3-8-15/h1-5,7-9,11,13-14H,6,10,12H2 |
| InChIKey | FUYIYONUSHVDKI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |