About 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine
3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine (PubChem CID 171431674) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine |
| PubChem CID | 171431674 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine |
| SMILES | C[C@@H]1CNC[C@H]1c1cccnc1N |
| InChI | InChI=1S/C10H15N3/c1-7-5-12-6-9(7)8-3-2-4-13-10(8)11/h2-4,7,9,12H,5-6H2,1H3,(H2,11,13)/t7-,9-/m1/s1 |
| InChIKey | PUCVRJROYPGJMU-VXNVDRBHSA-N |
| XLogP | 0.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine?
The IUPAC name of 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine (CID 171431674) is 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine.
What is the SMILES notation for 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine?
The canonical SMILES for 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine is C[C@@H]1CNC[C@H]1c1cccnc1N.
What is the InChIKey of 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine?
The InChIKey is PUCVRJROYPGJMU-VXNVDRBHSA-N. The full InChI is InChI=1S/C10H15N3/c1-7-5-12-6-9(7)8-3-2-4-13-10(8)11/h2-4,7,9,12H,5-6H2,1H3,(H2,11,13)/t7-,9-/m1/s1.
What are the key properties of 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine?
3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine has a molecular weight of 177.25 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-4-methylpyrrolidin-3-yl]pyridin-2-amine is sourced from PubChem (CID 171431674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).