About 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide
2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide (PubChem CID 171433792) has the molecular formula C8H13O5P
and a molecular weight of 220.16 g/mol. Its IUPAC name is 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide.
Molecular Properties
| Compound Name | 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide |
| PubChem CID | 171433792 |
| Molecular Formula | C8H13O5P |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide |
| SMILES | C=CC1COC(OP2(=O)CCCO2)O1 |
| InChI | InChI=1S/C8H13O5P/c1-2-7-6-10-8(12-7)13-14(9)5-3-4-11-14/h2,7-8H,1,3-6H2 |
| InChIKey | ZMKNBPNDKNPEAW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide?
The IUPAC name of 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide (CID 171433792) is 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide.
What is the SMILES notation for 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide?
The canonical SMILES for 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide is C=CC1COC(OP2(=O)CCCO2)O1.
What is the InChIKey of 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide?
The InChIKey is ZMKNBPNDKNPEAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O5P/c1-2-7-6-10-8(12-7)13-14(9)5-3-4-11-14/h2,7-8H,1,3-6H2.
What are the key properties of 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide?
2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide has a molecular weight of 220.16 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethenyl-1,3-dioxolan-2-yl)oxy]-1,2λ5-oxaphospholane 2-oxide is sourced from PubChem (CID 171433792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).