C57H47GeIrN3O-2 — CID 171435703
2-(3H-dibenzofuran-3-id-2-yl)-3-(2-phenylnaphthalen-1-yl)benzo[e]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane (PubChem CID 171435703) has the molecular formula C57H47GeIrN3O-2 and a molecular weight of 1054.85 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-2-yl)-3-(2-phenylnaphthalen-1-yl)benzo[e]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane.
| Compound Name | 2-(3H-dibenzofuran-3-id-2-yl)-3-(2-phenylnaphthalen-1-yl)benzo[e]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
|---|---|
| PubChem CID | 171435703 |
| Molecular Formula | C57H47GeIrN3O-2 |
| Molecular Weight | 1054.85 g/mol |
| Exact Mass | 1056.26 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-2-yl)-3-(2-phenylnaphthalen-1-yl)benzo[e]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir].[c-]1cc2oc3ccccc3c2cc1-c1nc2c3ccccc3ccc2n1-c1c(-c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C39H23N2O.C18H24GeN.Ir/c1-2-10-25(11-3-1)31-21-18-27-13-5-7-15-30(27)38(31)41-34-22-19-26-12-4-6-14-29(26)37(34)40-39(41)28-20-23-36-33(24-28)32-16-8-9-17-35(32)42-36;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h1-19,21-24H;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | XAIBWJIQEIYGLR-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.85 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|