About 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine
2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine (PubChem CID 171436743) has the molecular formula C16H19N
and a molecular weight of 231.37 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine.
Molecular Properties
| Compound Name | 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine |
| PubChem CID | 171436743 |
| Molecular Formula | C16H19N |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]c1nc(-c2cccc(C(C)(C)C)c2)c([2H])c([2H])c1C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H19N/c1-12-8-9-15(17-11-12)13-6-5-7-14(10-13)16(2,3)4/h5-11H,1-4H3/i1D3,8D,9D,11D |
| InChIKey | TZQZBXZAWXJZFS-BBCHDHLBSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine?
The IUPAC name of 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine (CID 171436743) is 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine.
What is the SMILES notation for 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine?
The canonical SMILES for 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine is [2H]c1nc(-c2cccc(C(C)(C)C)c2)c([2H])c([2H])c1C([2H])([2H])[2H].
What is the InChIKey of 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine?
The InChIKey is TZQZBXZAWXJZFS-BBCHDHLBSA-N. The full InChI is InChI=1S/C16H19N/c1-12-8-9-15(17-11-12)13-6-5-7-14(10-13)16(2,3)4/h5-11H,1-4H3/i1D3,8D,9D,11D.
What are the key properties of 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine?
2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine has a molecular weight of 231.37 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tert-butylphenyl)-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine is sourced from PubChem (CID 171436743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).