About 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one
3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one (PubChem CID 171437632) has the molecular formula C8H5BrFNOS
and a molecular weight of 262.10 g/mol. Its IUPAC name is 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one |
| PubChem CID | 171437632 |
| Molecular Formula | C8H5BrFNOS |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 260.93 |
| IUPAC Name | 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one |
| SMILES | Cn1cc(F)c2scc(Br)c2c1=O |
| InChI | InChI=1S/C8H5BrFNOS/c1-11-2-5(10)7-6(8(11)12)4(9)3-13-7/h2-3H,1H3 |
| InChIKey | HACNPSCCJCYRGR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one?
The IUPAC name of 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one (CID 171437632) is 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one.
What is the SMILES notation for 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one?
The canonical SMILES for 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one is Cn1cc(F)c2scc(Br)c2c1=O.
What is the InChIKey of 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one?
The InChIKey is HACNPSCCJCYRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrFNOS/c1-11-2-5(10)7-6(8(11)12)4(9)3-13-7/h2-3H,1H3.
What are the key properties of 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one?
3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one has a molecular weight of 262.10 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-fluoro-5-methylthieno[3,2-c]pyridin-4-one is sourced from PubChem (CID 171437632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).