C42H32N4 — CID 171439147
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1-dimethyl-3,5-dihydro-2H-indeno[2,1-b]carbazole (PubChem CID 171439147) has the molecular formula C42H32N4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1-dimethyl-3,5-dihydro-2H-indeno[2,1-b]carbazole.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1-dimethyl-3,5-dihydro-2H-indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 171439147 |
| Molecular Formula | C42H32N4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1-dimethyl-3,5-dihydro-2H-indeno[2,1-b]carbazole |
| SMILES | CC1(C)CC(c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)C=c2[nH]c3cc4c(cc3c21)-c1ccccc1C=4 |
| InChI | InChI=1S/C42H32N4/c1-42(2)25-32(23-37-38(42)35-24-34-31(22-36(35)43-37)21-29-16-9-10-19-33(29)34)28-17-11-18-30(20-28)41-45-39(26-12-5-3-6-13-26)44-40(46-41)27-14-7-4-8-15-27/h3-24,32,43H,25H2,1-2H3 |
| InChIKey | GJMQESHHTZDRFC-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |