C18H12ClNS — CID 171439174
1-chloro-8-methyl-7-phenyl-[1]benzothiolo[2,3-c]pyridine (PubChem CID 171439174) has the molecular formula C18H12ClNS and a molecular weight of 309.82 g/mol. Its IUPAC name is 1-chloro-8-methyl-7-phenyl-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | 1-chloro-8-methyl-7-phenyl-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 171439174 |
| Molecular Formula | C18H12ClNS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-chloro-8-methyl-7-phenyl-[1]benzothiolo[2,3-c]pyridine |
| SMILES | Cc1c(-c2ccccc2)ccc2c1sc1c(Cl)nccc12 |
| InChI | InChI=1S/C18H12ClNS/c1-11-13(12-5-3-2-4-6-12)7-8-14-15-9-10-20-18(19)17(15)21-16(11)14/h2-10H,1H3 |
| InChIKey | VJNKEDVERXMQON-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|