C19H31NO4 — CID 171439597
(1R,3S,6S,7R,10S,11S,12S,13R)-7-[(dimethylamino)methyl]-13-hydroxy-12-methoxy-3,12-dimethyl-9-oxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one (PubChem CID 171439597) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is (1R,3S,6S,7R,10S,11S,12S,13R)-7-[(dimethylamino)methyl]-13-hydroxy-12-methoxy-3,12-dimethyl-9-oxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one.
| Compound Name | (1R,3S,6S,7R,10S,11S,12S,13R)-7-[(dimethylamino)methyl]-13-hydroxy-12-methoxy-3,12-dimethyl-9-oxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one |
|---|---|
| PubChem CID | 171439597 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (1R,3S,6S,7R,10S,11S,12S,13R)-7-[(dimethylamino)methyl]-13-hydroxy-12-methoxy-3,12-dimethyl-9-oxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one |
| SMILES | CO[C@]1(C)[C@H](O)C[C@@]23C[C@]2(C)CC[C@@H]2[C@H](OC(=O)[C@H]2CN(C)C)[C@@H]13 |
| InChI | InChI=1S/C19H31NO4/c1-17-7-6-11-12(9-20(3)4)16(22)24-14(11)15-18(2,23-5)13(21)8-19(15,17)10-17/h11-15,21H,6-10H2,1-5H3/t11-,12-,13+,14-,15-,17-,18+,19-/m0/s1 |
| InChIKey | BKTHDXZQLLVVMV-FHDCPALDSA-N |
| XLogP | 1.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |