C30H29N3O3 — CID 171439850
5-(butoxymethyl)-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 171439850) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 5-(butoxymethyl)-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(butoxymethyl)-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 171439850 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 5-(butoxymethyl)-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCOCc1nc2c(-c3ccccc3)c(-c3ccccc3)[nH]n2c(=O)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H29N3O3/c1-3-4-19-36-20-25-26(22-15-17-24(35-2)18-16-22)30(34)33-29(31-25)27(21-11-7-5-8-12-21)28(32-33)23-13-9-6-10-14-23/h5-18,32H,3-4,19-20H2,1-2H3 |
| InChIKey | WZVOZBVCTUVHDS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|