C27H14N2O3S — CID 171441390
(6E)-6-(8-oxa-14-thia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-11-ylmethylidene)cyclopenta[c]pyridine-5,7-dione (PubChem CID 171441390) has the molecular formula C27H14N2O3S and a molecular weight of 446.49 g/mol. Its IUPAC name is (6E)-6-(8-oxa-14-thia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-11-ylmethylidene)cyclopenta[c]pyridine-5,7-dione.
| Compound Name | (6E)-6-(8-oxa-14-thia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-11-ylmethylidene)cyclopenta[c]pyridine-5,7-dione |
|---|---|
| PubChem CID | 171441390 |
| Molecular Formula | C27H14N2O3S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (6E)-6-(8-oxa-14-thia-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-11-ylmethylidene)cyclopenta[c]pyridine-5,7-dione |
| SMILES | O=C1/C(=C\c2cc3c4c(c2)Sc2ccccc2N4c2ccccc2O3)C(=O)c2cnccc21 |
| InChI | InChI=1S/C27H14N2O3S/c30-26-16-9-10-28-14-18(16)27(31)17(26)11-15-12-22-25-24(13-15)33-23-8-4-2-6-20(23)29(25)19-5-1-3-7-21(19)32-22/h1-14H/b17-11+ |
| InChIKey | PVOVFSBPDXPKFG-GZTJUZNOSA-N |
| XLogP | 6.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|