C27H25ClF3N5O6 — CID 171441718
ethyl 5-[(6S,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carboxylate (PubChem CID 171441718) has the molecular formula C27H25ClF3N5O6 and a molecular weight of 607.97 g/mol. Its IUPAC name is ethyl 5-[(6S,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[(6S,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 171441718 |
| Molecular Formula | C27H25ClF3N5O6 |
| Molecular Weight | 607.97 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | ethyl 5-[(6S,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2OC3COC(c4ccccc4)O[C@@H]3[C@H](N=[N+]=[N-])C2OC)n(-c2cc(Cl)ccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C27H25ClF3N5O6/c1-3-39-25(37)17-12-19(36(34-17)18-11-15(28)9-10-16(18)27(29,30)31)22-24(38-2)21(33-35-32)23-20(41-22)13-40-26(42-23)14-7-5-4-6-8-14/h4-12,20-24,26H,3,13H2,1-2H3/t20?,21-,22-,23-,24?,26?/m0/s1 |
| InChIKey | PNDVMCPTGUFUMS-MMKHITKOSA-N |
| XLogP | 5.97 |
| TPSA | 129.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.97 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|