C17H8Cl2N2O2 — CID 171441951
7,17-dichloro-12-methyl-10,14-dioxa-8,16-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene (PubChem CID 171441951) has the molecular formula C17H8Cl2N2O2 and a molecular weight of 343.17 g/mol. Its IUPAC name is 7,17-dichloro-12-methyl-10,14-dioxa-8,16-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene.
| Compound Name | 7,17-dichloro-12-methyl-10,14-dioxa-8,16-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 171441951 |
| Molecular Formula | C17H8Cl2N2O2 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 7,17-dichloro-12-methyl-10,14-dioxa-8,16-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene |
| SMILES | Cc1c2oc3nc(Cl)ccc3c2cc2c1oc1nc(Cl)ccc12 |
| InChI | InChI=1S/C17H8Cl2N2O2/c1-7-14-10(8-2-4-12(18)20-16(8)22-14)6-11-9-3-5-13(19)21-17(9)23-15(7)11/h2-6H,1H3 |
| InChIKey | GHMIIBSVLCOOOC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|