C9H18O5 — CID 171442655
(1S,2R,4S,5R)-6-propan-2-ylcyclohexane-1,2,3,4,5-pentol (PubChem CID 171442655) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,2R,4S,5R)-6-propan-2-ylcyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,4S,5R)-6-propan-2-ylcyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 171442655 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (1S,2R,4S,5R)-6-propan-2-ylcyclohexane-1,2,3,4,5-pentol |
| SMILES | CC(C)C1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O5/c1-3(2)4-5(10)7(12)9(14)8(13)6(4)11/h3-14H,1-2H3/t4?,5-,6+,7+,8-,9? |
| InChIKey | UBIFGDVFNGMPQP-RHQBDSIZSA-N |
| XLogP | -1.92 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |