C16H18N4O3S — CID 171442835
(2S)-N-but-2-ynyl-1-[(5-methyl-1H-indazol-7-yl)sulfonyl]azetidine-2-carboxamide (PubChem CID 171442835) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S)-N-but-2-ynyl-1-[(5-methyl-1H-indazol-7-yl)sulfonyl]azetidine-2-carboxamide.
| Compound Name | (2S)-N-but-2-ynyl-1-[(5-methyl-1H-indazol-7-yl)sulfonyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 171442835 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2S)-N-but-2-ynyl-1-[(5-methyl-1H-indazol-7-yl)sulfonyl]azetidine-2-carboxamide |
| SMILES | CC#CCNC(=O)[C@@H]1CCN1S(=O)(=O)c1cc(C)cc2cn[nH]c12 |
| InChI | InChI=1S/C16H18N4O3S/c1-3-4-6-17-16(21)13-5-7-20(13)24(22,23)14-9-11(2)8-12-10-18-19-15(12)14/h8-10,13H,5-7H2,1-2H3,(H,17,21)(H,18,19)/t13-/m0/s1 |
| InChIKey | UXNQLRJCOKNMRO-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|