C20H29ClN2O — CID 171443182
(2S)-1-[(1R,2R)-7-chloro-1-propan-2-yl-2,3-dihydro-1H-inden-2-yl]-N,N,3,3-tetramethylazetidine-2-carboxamide (PubChem CID 171443182) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is (2S)-1-[(1R,2R)-7-chloro-1-propan-2-yl-2,3-dihydro-1H-inden-2-yl]-N,N,3,3-tetramethylazetidine-2-carboxamide.
| Compound Name | (2S)-1-[(1R,2R)-7-chloro-1-propan-2-yl-2,3-dihydro-1H-inden-2-yl]-N,N,3,3-tetramethylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 171443182 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2S)-1-[(1R,2R)-7-chloro-1-propan-2-yl-2,3-dihydro-1H-inden-2-yl]-N,N,3,3-tetramethylazetidine-2-carboxamide |
| SMILES | CC(C)[C@@H]1c2c(Cl)cccc2C[C@H]1N1CC(C)(C)[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C20H29ClN2O/c1-12(2)16-15(10-13-8-7-9-14(21)17(13)16)23-11-20(3,4)18(23)19(24)22(5)6/h7-9,12,15-16,18H,10-11H2,1-6H3/t15-,16+,18-/m1/s1 |
| InChIKey | RELVEVFEGRVQCQ-SOLBZPMBSA-N |
| XLogP | 3.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |