C23H31N — CID 171443253
2,2,4,6,6-pentamethyl-4-[4-(4-methylphenyl)phenyl]piperidine (PubChem CID 171443253) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-4-[4-(4-methylphenyl)phenyl]piperidine.
| Compound Name | 2,2,4,6,6-pentamethyl-4-[4-(4-methylphenyl)phenyl]piperidine |
|---|---|
| PubChem CID | 171443253 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-4-[4-(4-methylphenyl)phenyl]piperidine |
| SMILES | Cc1ccc(-c2ccc(C3(C)CC(C)(C)NC(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H31N/c1-17-7-9-18(10-8-17)19-11-13-20(14-12-19)23(6)15-21(2,3)24-22(4,5)16-23/h7-14,24H,15-16H2,1-6H3 |
| InChIKey | ZHHNJGUJQHBTBF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |