About N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide
N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide (PubChem CID 171444689) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide.
Molecular Properties
| Compound Name | N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide |
| PubChem CID | 171444689 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide |
| SMILES | CCC=C(C)C(=O)NC1C=CC=C1 |
| InChI | InChI=1S/C11H15NO/c1-3-6-9(2)11(13)12-10-7-4-5-8-10/h4-8,10H,3H2,1-2H3,(H,12,13) |
| InChIKey | AHSHNCOMJRUGNC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide?
The IUPAC name of N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide (CID 171444689) is N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide.
What is the SMILES notation for N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide?
The canonical SMILES for N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide is CCC=C(C)C(=O)NC1C=CC=C1.
What is the InChIKey of N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide?
The InChIKey is AHSHNCOMJRUGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-3-6-9(2)11(13)12-10-7-4-5-8-10/h4-8,10H,3H2,1-2H3,(H,12,13).
What are the key properties of N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide?
N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide has a molecular weight of 177.25 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-2,4-dien-1-yl-2-methylpent-2-enamide is sourced from PubChem (CID 171444689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).