C13H18ClFN2O — CID 17144545
2-chloro-N-[2-(diethylamino)ethyl]-4-fluorobenzamide (PubChem CID 17144545) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)ethyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 17144545 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)ethyl]-4-fluorobenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O/c1-3-17(4-2)8-7-16-13(18)11-6-5-10(15)9-12(11)14/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | MIHMIGVOBXYRFJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |