About ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate
ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate (PubChem CID 171446215) has the molecular formula C21H28BrF3N2O7S
and a molecular weight of 589.43 g/mol. Its IUPAC name is ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate |
| PubChem CID | 171446215 |
| Molecular Formula | C21H28BrF3N2O7S |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(c2cc(OS(=O)(=O)C(F)(F)F)ccc2Br)C1 |
| InChI | InChI=1S/C21H28BrF3N2O7S/c1-19(2,3)32-17(28)26-9-10-27(18(29)33-20(4,5)6)16(12-26)14-11-13(7-8-15(14)22)34-35(30,31)21(23,24)25/h7-8,11,16H,9-10,12H2,1-6H3 |
| InChIKey | QOOKRHYCMCZDFQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate?
The IUPAC name of ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate (CID 171446215) is ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate.
What is the SMILES notation for ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate?
The canonical SMILES for ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(c2cc(OS(=O)(=O)C(F)(F)F)ccc2Br)C1.
What is the InChIKey of ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate?
The InChIKey is QOOKRHYCMCZDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28BrF3N2O7S/c1-19(2,3)32-17(28)26-9-10-27(18(29)33-20(4,5)6)16(12-26)14-11-13(7-8-15(14)22)34-35(30,31)21(23,24)25/h7-8,11,16H,9-10,12H2,1-6H3.
What are the key properties of ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate?
ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate has a molecular weight of 589.43 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylate is sourced from PubChem (CID 171446215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).