C16H17FNOP — CID 171446485
1-(7-fluoro-3-propan-2-ylquinolin-4-yl)-2,5-dihydro-1λ5-phosphole 1-oxide (PubChem CID 171446485) has the molecular formula C16H17FNOP and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(7-fluoro-3-propan-2-ylquinolin-4-yl)-2,5-dihydro-1λ5-phosphole 1-oxide.
| Compound Name | 1-(7-fluoro-3-propan-2-ylquinolin-4-yl)-2,5-dihydro-1λ5-phosphole 1-oxide |
|---|---|
| PubChem CID | 171446485 |
| Molecular Formula | C16H17FNOP |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(7-fluoro-3-propan-2-ylquinolin-4-yl)-2,5-dihydro-1λ5-phosphole 1-oxide |
| SMILES | CC(C)c1cnc2cc(F)ccc2c1P1(=O)CC=CC1 |
| InChI | InChI=1S/C16H17FNOP/c1-11(2)14-10-18-15-9-12(17)5-6-13(15)16(14)20(19)7-3-4-8-20/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | MHOFBQYBZZZIRL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|