C33H20N6O — CID 171448038
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-10,15,21-triazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-14-one (PubChem CID 171448038) has the molecular formula C33H20N6O and a molecular weight of 516.56 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-10,15,21-triazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-14-one.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-10,15,21-triazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-14-one |
|---|---|
| PubChem CID | 171448038 |
| Molecular Formula | C33H20N6O |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-10,15,21-triazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-14-one |
| SMILES | O=c1nc2ccccn2c2cc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3cc12 |
| InChI | InChI=1S/C33H20N6O/c40-32-25-20-28-24(19-27(25)38-18-10-9-17-29(38)34-32)23-15-7-8-16-26(23)39(28)33-36-30(21-11-3-1-4-12-21)35-31(37-33)22-13-5-2-6-14-22/h1-20H |
| InChIKey | SLTIGDSXAZQWSY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|