C15H24N2O8 — CID 171448464
N-[[[2-[9-(hydroxymethyl)-11-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-4-yl]acetyl]amino]methyl]propanamide (PubChem CID 171448464) has the molecular formula C15H24N2O8 and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[[[2-[9-(hydroxymethyl)-11-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-4-yl]acetyl]amino]methyl]propanamide.
| Compound Name | N-[[[2-[9-(hydroxymethyl)-11-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-4-yl]acetyl]amino]methyl]propanamide |
|---|---|
| PubChem CID | 171448464 |
| Molecular Formula | C15H24N2O8 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[[[2-[9-(hydroxymethyl)-11-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-4-yl]acetyl]amino]methyl]propanamide |
| SMILES | CCC(=O)NCNC(=O)CC1OC2OC3C(CO)OC(C)OC3C2O1 |
| InChI | InChI=1S/C15H24N2O8/c1-3-9(19)16-6-17-10(20)4-11-23-14-13-12(25-15(14)24-11)8(5-18)21-7(2)22-13/h7-8,11-15,18H,3-6H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | JRLREMXMKDIIJJ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|