C67H58N4S — CID 171449068
3-N-[1-(4-methyl-N-(4-methylphenyl)anilino)dibenzothiophen-3-yl]-1-N,1-N,3-N,5-N,5-N-pentakis(4-methylphenyl)benzene-1,3,5-triamine (PubChem CID 171449068) has the molecular formula C67H58N4S and a molecular weight of 951.30 g/mol. Its IUPAC name is 3-N-[1-(4-methyl-N-(4-methylphenyl)anilino)dibenzothiophen-3-yl]-1-N,1-N,3-N,5-N,5-N-pentakis(4-methylphenyl)benzene-1,3,5-triamine.
| Compound Name | 3-N-[1-(4-methyl-N-(4-methylphenyl)anilino)dibenzothiophen-3-yl]-1-N,1-N,3-N,5-N,5-N-pentakis(4-methylphenyl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 171449068 |
| Molecular Formula | C67H58N4S |
| Molecular Weight | 951.30 g/mol |
| Exact Mass | 950.44 |
| IUPAC Name | 3-N-[1-(4-methyl-N-(4-methylphenyl)anilino)dibenzothiophen-3-yl]-1-N,1-N,3-N,5-N,5-N-pentakis(4-methylphenyl)benzene-1,3,5-triamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc(N(c3ccc(C)cc3)c3cc(N(c4ccc(C)cc4)c4ccc(C)cc4)c4c(c3)sc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C67H58N4S/c1-45-12-26-52(27-13-45)68(53-28-14-46(2)15-29-53)59-40-60(69(54-30-16-47(3)17-31-54)55-32-18-48(4)19-33-55)42-61(41-59)70(56-34-20-49(5)21-35-56)62-43-64(67-63-10-8-9-11-65(63)72-66(67)44-62)71(57-36-22-50(6)23-37-57)58-38-24-51(7)25-39-58/h8-44H,1-7H3 |
| InChIKey | RDIIQDRHSWUSQN-UHFFFAOYSA-N |
| XLogP | 20.09 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.30 |
| LogP ≤ 5 | 20.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |