C22H31IO3 — CID 171450104
(4bR,8aS)-4b-(iodomethyl)-3,4-dimethoxy-8,8-dimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one (PubChem CID 171450104) has the molecular formula C22H31IO3 and a molecular weight of 470.39 g/mol. Its IUPAC name is (4bR,8aS)-4b-(iodomethyl)-3,4-dimethoxy-8,8-dimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one.
| Compound Name | (4bR,8aS)-4b-(iodomethyl)-3,4-dimethoxy-8,8-dimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one |
|---|---|
| PubChem CID | 171450104 |
| Molecular Formula | C22H31IO3 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (4bR,8aS)-4b-(iodomethyl)-3,4-dimethoxy-8,8-dimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one |
| SMILES | COc1c(C(C)C)cc2c(c1OC)[C@@]1(CI)CCCC(C)(C)[C@@H]1C(=O)C2 |
| InChI | InChI=1S/C22H31IO3/c1-13(2)15-10-14-11-16(24)20-21(3,4)8-7-9-22(20,12-23)17(14)19(26-6)18(15)25-5/h10,13,20H,7-9,11-12H2,1-6H3/t20-,22-/m0/s1 |
| InChIKey | QHWUBGVKULLYDX-UNMCSNQZSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|