C26H27ClN4O3S — CID 171450650
5-[(3R)-7-chloro-2-methyl-3-(2-methylpropyl)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1,2-benzoxazol-3-amine (PubChem CID 171450650) has the molecular formula C26H27ClN4O3S and a molecular weight of 511.05 g/mol. Its IUPAC name is 5-[(3R)-7-chloro-2-methyl-3-(2-methylpropyl)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1,2-benzoxazol-3-amine.
| Compound Name | 5-[(3R)-7-chloro-2-methyl-3-(2-methylpropyl)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 171450650 |
| Molecular Formula | C26H27ClN4O3S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 5-[(3R)-7-chloro-2-methyl-3-(2-methylpropyl)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1,2-benzoxazol-3-amine |
| SMILES | CC(C)C[C@@H]1CN(c2ccccc2)c2cc(Cl)c(-c3ccc4onc(N)c4c3)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C26H27ClN4O3S/c1-16(2)11-19-15-31(18-7-5-4-6-8-18)23-14-22(27)20(13-25(23)35(32,33)30(19)3)17-9-10-24-21(12-17)26(28)29-34-24/h4-10,12-14,16,19H,11,15H2,1-3H3,(H2,28,29)/t19-/m1/s1 |
| InChIKey | FRURMFJSHCODLE-LJQANCHMSA-N |
| XLogP | 5.92 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |