C50H33N — CID 171450999
2,3,5,6-tetradeuterio-N-(3-phenanthren-9-ylphenyl)-N-phenyl-4-triphenylen-2-ylaniline (PubChem CID 171450999) has the molecular formula C50H33N and a molecular weight of 651.85 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-(3-phenanthren-9-ylphenyl)-N-phenyl-4-triphenylen-2-ylaniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-(3-phenanthren-9-ylphenyl)-N-phenyl-4-triphenylen-2-ylaniline |
|---|---|
| PubChem CID | 171450999 |
| Molecular Formula | C50H33N |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-(3-phenanthren-9-ylphenyl)-N-phenyl-4-triphenylen-2-ylaniline |
| SMILES | [2H]c1c([2H])c(N(c2ccccc2)c2cccc(-c3cc4ccccc4c4ccccc34)c2)c([2H])c([2H])c1-c1ccc2c3ccccc3c3ccccc3c2c1 |
| InChI | InChI=1S/C50H33N/c1-2-15-38(16-3-1)51(40-17-12-14-36(31-40)49-33-37-13-4-5-18-41(37)42-19-6-10-23-46(42)49)39-28-25-34(26-29-39)35-27-30-48-45-22-8-7-20-43(45)44-21-9-11-24-47(44)50(48)32-35/h1-33H/i25D,26D,28D,29D |
| InChIKey | MWLJFXAJUCHUKN-KJVZXISESA-N |
| XLogP | 14.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|