C55H39N — CID 171451168
9,9-diphenyl-N-(2-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 171451168) has the molecular formula C55H39N and a molecular weight of 717.95 g/mol. Its IUPAC name is 9,9-diphenyl-N-(2-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-diphenyl-N-(2-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 171451168 |
| Molecular Formula | C55H39N |
| Molecular Weight | 717.95 g/mol |
| Exact Mass | 717.33 |
| IUPAC Name | 9,9-diphenyl-N-(2-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2ccccc2-c2ccccc2)c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C55H39N/c1-5-17-40(18-6-1)41-29-31-42(32-30-41)43-33-35-47(36-34-43)56(54-28-16-14-25-49(54)44-19-7-2-8-20-44)48-37-38-51-50-26-13-15-27-52(50)55(53(51)39-48,45-21-9-3-10-22-45)46-23-11-4-12-24-46/h1-39H/i33D,34D,35D,36D |
| InChIKey | MKXWZRLFHWYEOY-IYLKRGPFSA-N |
| XLogP | 14.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.95 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |