C50H33NO — CID 171452364
2,3,5,6-tetradeuterio-4-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline (PubChem CID 171452364) has the molecular formula C50H33NO and a molecular weight of 671.87 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline |
|---|---|
| PubChem CID | 171452364 |
| Molecular Formula | C50H33NO |
| Molecular Weight | 671.87 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-naphthalen-2-yl-N-(4-naphthalen-1-ylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4ccccc34)cc2)c2c([2H])c([2H])c(-c3cccc4c3oc3ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H33NO/c1-2-11-39-33-40(20-19-34(39)9-1)35-21-27-41(28-22-35)51(42-29-23-37(24-30-42)45-15-7-12-36-10-3-4-13-44(36)45)43-31-25-38(26-32-43)46-16-8-17-48-47-14-5-6-18-49(47)52-50(46)48/h1-33H/i21D,22D,25D,26D,27D,28D,31D,32D |
| InChIKey | HKUOSAFFJDVFMJ-XAVGCNBTSA-N |
| XLogP | 14.36 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.87 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |