C54H41NO — CID 171452477
9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-4-yl)phenyl]fluoren-2-amine (PubChem CID 171452477) has the molecular formula C54H41NO and a molecular weight of 727.98 g/mol. Its IUPAC name is 9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-4-yl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-4-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 171452477 |
| Molecular Formula | C54H41NO |
| Molecular Weight | 727.98 g/mol |
| Exact Mass | 727.37 |
| IUPAC Name | 9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9,9-dimethylfluoren-4-yl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c(-c3cccc4c3oc3ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc2c1-c1ccccc1C2(C)C |
| InChI | InChI=1S/C54H41NO/c1-53(2)47-20-9-6-15-45(47)51-39(16-12-21-48(51)53)34-23-27-36(28-24-34)55(38-31-32-42-41-13-5-8-19-46(41)54(3,4)49(42)33-38)37-29-25-35(26-30-37)40-17-11-18-44-43-14-7-10-22-50(43)56-52(40)44/h5-33H,1-4H3/i23D,24D,25D,26D,27D,28D,29D,30D |
| InChIKey | WRNGTZJRMZKCER-YWSGCUSSSA-N |
| XLogP | 15.00 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.98 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |