C33H35N8O2+ — CID 171453812
1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]prop-2-en-1-one (PubChem CID 171453812) has the molecular formula C33H35N8O2+ and a molecular weight of 575.70 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171453812 |
| Molecular Formula | C33H35N8O2+ |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]prop-2-en-1-one |
| SMILES | C=C(C[n+]1ccc(N(C)C)cc1)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C33H35N8O2/c1-23(20-39-18-15-25(16-19-39)38(2)3)33(42)40-17-7-8-26(21-40)41-32-29(31(34)35-22-36-32)30(37-41)24-11-13-28(14-12-24)43-27-9-5-4-6-10-27/h4-6,9-16,18-19,22,26H,1,7-8,17,20-21H2,2-3H3,(H2,34,35,36)/q+1/t26-/m1/s1 |
| InChIKey | KTVFNPKWIHTCNW-AREMUKBSSA-N |
| XLogP | 4.64 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|