C22H20BrCl2FN4 — CID 171454107
(1S,4R)-N-benzyl-7-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-N-methyl-7-azabicyclo[2.2.1]heptan-2-amine (PubChem CID 171454107) has the molecular formula C22H20BrCl2FN4 and a molecular weight of 510.24 g/mol. Its IUPAC name is (1S,4R)-N-benzyl-7-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-N-methyl-7-azabicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,4R)-N-benzyl-7-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-N-methyl-7-azabicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 171454107 |
| Molecular Formula | C22H20BrCl2FN4 |
| Molecular Weight | 510.24 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | (1S,4R)-N-benzyl-7-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-N-methyl-7-azabicyclo[2.2.1]heptan-2-amine |
| SMILES | CN(Cc1ccccc1)C1C[C@H]2CC[C@@H]1N2c1nc(Cl)nc2c(F)c(Br)c(Cl)cc12 |
| InChI | InChI=1S/C22H20BrCl2FN4/c1-29(11-12-5-3-2-4-6-12)17-9-13-7-8-16(17)30(13)21-14-10-15(24)18(23)19(26)20(14)27-22(25)28-21/h2-6,10,13,16-17H,7-9,11H2,1H3/t13-,16+,17?/m1/s1 |
| InChIKey | XTFSSONWFBVDKT-WBTZKQGOSA-N |
| XLogP | 6.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.24 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|