C32H45NO3 — CID 171454230
(4aR,6aR,6aS,6bR,8aR,11R,12S,12aS,14bR)-8a-(2-hydroxyethyl)-2-isocyano-4,4,6a,6b,11,12,14b-heptamethyl-5,6,6a,7,8,9,10,11,12,12a-decahydro-4aH-picene-3,13-dione (PubChem CID 171454230) has the molecular formula C32H45NO3 and a molecular weight of 491.72 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aR,11R,12S,12aS,14bR)-8a-(2-hydroxyethyl)-2-isocyano-4,4,6a,6b,11,12,14b-heptamethyl-5,6,6a,7,8,9,10,11,12,12a-decahydro-4aH-picene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bR,8aR,11R,12S,12aS,14bR)-8a-(2-hydroxyethyl)-2-isocyano-4,4,6a,6b,11,12,14b-heptamethyl-5,6,6a,7,8,9,10,11,12,12a-decahydro-4aH-picene-3,13-dione |
|---|---|
| PubChem CID | 171454230 |
| Molecular Formula | C32H45NO3 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aR,11R,12S,12aS,14bR)-8a-(2-hydroxyethyl)-2-isocyano-4,4,6a,6b,11,12,14b-heptamethyl-5,6,6a,7,8,9,10,11,12,12a-decahydro-4aH-picene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(CCO)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H45NO3/c1-19-9-12-32(15-16-34)14-13-31(7)26(25(32)20(19)2)22(35)17-24-29(5)18-21(33-8)27(36)28(3,4)23(29)10-11-30(24,31)6/h17-20,23,25-26,34H,9-16H2,1-7H3/t19-,20+,23+,25+,26-,29+,30-,31-,32-/m1/s1 |
| InChIKey | VCHULWLCVGOLAQ-UEAKSGNQSA-N |
| XLogP | 6.80 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|