About S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate
S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate (PubChem CID 171454438) has the molecular formula C21H28O4S3
and a molecular weight of 440.65 g/mol. Its IUPAC name is S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate.
Molecular Properties
| Compound Name | S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate |
| PubChem CID | 171454438 |
| Molecular Formula | C21H28O4S3 |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate |
| SMILES | CCC(C)(C)C(=O)SCCCCCCS(=O)(=O)c1cc(=O)sc2ccccc12 |
| InChI | InChI=1S/C21H28O4S3/c1-4-21(2,3)20(23)26-13-9-5-6-10-14-28(24,25)18-15-19(22)27-17-12-8-7-11-16(17)18/h7-8,11-12,15H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | CAXMDKOVWSHUOW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate?
The IUPAC name of S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate (CID 171454438) is S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate.
What is the SMILES notation for S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate?
The canonical SMILES for S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate is CCC(C)(C)C(=O)SCCCCCCS(=O)(=O)c1cc(=O)sc2ccccc12.
What is the InChIKey of S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate?
The InChIKey is CAXMDKOVWSHUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O4S3/c1-4-21(2,3)20(23)26-13-9-5-6-10-14-28(24,25)18-15-19(22)27-17-12-8-7-11-16(17)18/h7-8,11-12,15H,4-6,9-10,13-14H2,1-3H3.
What are the key properties of S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate?
S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate has a molecular weight of 440.65 g/mol, XLogP of 5.29, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[6-(2-oxothiochromen-4-yl)sulfonylhexyl] 2,2-dimethylbutanethioate is sourced from PubChem (CID 171454438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).