C25H25ClN8OS — CID 171454690
3-[(3S)-3-amino-1'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-1,2,4-triazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]-N-methylprop-2-ynamide (PubChem CID 171454690) has the molecular formula C25H25ClN8OS and a molecular weight of 521.05 g/mol. Its IUPAC name is 3-[(3S)-3-amino-1'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-1,2,4-triazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]-N-methylprop-2-ynamide.
| Compound Name | 3-[(3S)-3-amino-1'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-1,2,4-triazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]-N-methylprop-2-ynamide |
|---|---|
| PubChem CID | 171454690 |
| Molecular Formula | C25H25ClN8OS |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 3-[(3S)-3-amino-1'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-1,2,4-triazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-5-yl]-N-methylprop-2-ynamide |
| SMILES | CNC(=O)C#Cc1ccc2c(c1)[C@@H](N)C1(CCN(c3ncc(Sc4ccnc(N)c4Cl)nn3)CC1)C2 |
| InChI | InChI=1S/C25H25ClN8OS/c1-29-19(35)5-3-15-2-4-16-13-25(22(27)17(16)12-15)7-10-34(11-8-25)24-31-14-20(32-33-24)36-18-6-9-30-23(28)21(18)26/h2,4,6,9,12,14,22H,7-8,10-11,13,27H2,1H3,(H2,28,30)(H,29,35)/t22-/m1/s1 |
| InChIKey | OFVXDRDHDVQLGX-JOCHJYFZSA-N |
| XLogP | 2.59 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|