About 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine
3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine (PubChem CID 171454817) has the molecular formula C8H5Cl2N5S
and a molecular weight of 274.14 g/mol. Its IUPAC name is 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine |
| PubChem CID | 171454817 |
| Molecular Formula | C8H5Cl2N5S |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine |
| SMILES | Nc1nccc(Sc2cnc(Cl)nn2)c1Cl |
| InChI | InChI=1S/C8H5Cl2N5S/c9-6-4(1-2-12-7(6)11)16-5-3-13-8(10)15-14-5/h1-3H,(H2,11,12) |
| InChIKey | SVERIZOYLWHRIV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine?
The IUPAC name of 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine (CID 171454817) is 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine.
What is the SMILES notation for 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine?
The canonical SMILES for 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine is Nc1nccc(Sc2cnc(Cl)nn2)c1Cl.
What is the InChIKey of 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine?
The InChIKey is SVERIZOYLWHRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N5S/c9-6-4(1-2-12-7(6)11)16-5-3-13-8(10)15-14-5/h1-3H,(H2,11,12).
What are the key properties of 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine?
3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine has a molecular weight of 274.14 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(3-chloro-1,2,4-triazin-6-yl)sulfanyl]pyridin-2-amine is sourced from PubChem (CID 171454817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).