About 1,4-ditert-butylpyrrolo[1,2-a]pyrazine
1,4-ditert-butylpyrrolo[1,2-a]pyrazine (PubChem CID 171454856) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,4-ditert-butylpyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 1,4-ditert-butylpyrrolo[1,2-a]pyrazine |
| PubChem CID | 171454856 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1,4-ditert-butylpyrrolo[1,2-a]pyrazine |
| SMILES | CC(C)(C)c1ncc(C(C)(C)C)n2cccc12 |
| InChI | InChI=1S/C15H22N2/c1-14(2,3)12-10-16-13(15(4,5)6)11-8-7-9-17(11)12/h7-10H,1-6H3 |
| InChIKey | KXHHFYNUJNHNLJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-ditert-butylpyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylpyrrolo[1,2-a]pyrazine?
The IUPAC name of 1,4-ditert-butylpyrrolo[1,2-a]pyrazine (CID 171454856) is 1,4-ditert-butylpyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 1,4-ditert-butylpyrrolo[1,2-a]pyrazine?
The canonical SMILES for 1,4-ditert-butylpyrrolo[1,2-a]pyrazine is CC(C)(C)c1ncc(C(C)(C)C)n2cccc12.
What is the InChIKey of 1,4-ditert-butylpyrrolo[1,2-a]pyrazine?
The InChIKey is KXHHFYNUJNHNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-14(2,3)12-10-16-13(15(4,5)6)11-8-7-9-17(11)12/h7-10H,1-6H3.
What are the key properties of 1,4-ditert-butylpyrrolo[1,2-a]pyrazine?
1,4-ditert-butylpyrrolo[1,2-a]pyrazine has a molecular weight of 230.35 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylpyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 171454856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).