About [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate
[4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate (PubChem CID 171457374) has the molecular formula C17H9ClF3NO3
and a molecular weight of 367.71 g/mol. Its IUPAC name is [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate.
Molecular Properties
| Compound Name | [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate |
| PubChem CID | 171457374 |
| Molecular Formula | C17H9ClF3NO3 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate |
| SMILES | O=COc1ccc(-c2ncc(-c3cc(C(F)(F)F)ccc3Cl)o2)cc1 |
| InChI | InChI=1S/C17H9ClF3NO3/c18-14-6-3-11(17(19,20)21)7-13(14)15-8-22-16(25-15)10-1-4-12(5-2-10)24-9-23/h1-9H |
| InChIKey | SFQFMOHEZAWYTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate?
The IUPAC name of [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate (CID 171457374) is [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate.
What is the SMILES notation for [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate?
The canonical SMILES for [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate is O=COc1ccc(-c2ncc(-c3cc(C(F)(F)F)ccc3Cl)o2)cc1.
What is the InChIKey of [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate?
The InChIKey is SFQFMOHEZAWYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF3NO3/c18-14-6-3-11(17(19,20)21)7-13(14)15-8-22-16(25-15)10-1-4-12(5-2-10)24-9-23/h1-9H.
What are the key properties of [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate?
[4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate has a molecular weight of 367.71 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]phenyl] formate is sourced from PubChem (CID 171457374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).