C24H31F3N6O3 — CID 171457503
[12-[(3R,4S)-4-ethyl-1-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl hexanoate (PubChem CID 171457503) has the molecular formula C24H31F3N6O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is [12-[(3R,4S)-4-ethyl-1-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl hexanoate.
| Compound Name | [12-[(3R,4S)-4-ethyl-1-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl hexanoate |
|---|---|
| PubChem CID | 171457503 |
| Molecular Formula | C24H31F3N6O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | [12-[(3R,4S)-4-ethyl-1-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCn1ccc2c1ncc1ncc([C@H]3CN(C(=O)NCC(F)(F)F)C[C@H]3CC)n12 |
| InChI | InChI=1S/C24H31F3N6O3/c1-3-5-6-7-21(34)36-15-31-9-8-18-22(31)29-11-20-28-10-19(33(18)20)17-13-32(12-16(17)4-2)23(35)30-14-24(25,26)27/h8-11,16-17H,3-7,12-15H2,1-2H3,(H,30,35)/t16-,17+/m1/s1 |
| InChIKey | RNVVGUKPPWWPQQ-SJORKVTESA-N |
| XLogP | 4.46 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|