About 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide
2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide (PubChem CID 171458820) has the molecular formula C10H13N3O3S
and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide |
| PubChem CID | 171458820 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide |
| SMILES | C[C@@H](/C=C/S(C)(=O)=O)c1ncc(C(N)=O)cn1 |
| InChI | InChI=1S/C10H13N3O3S/c1-7(3-4-17(2,15)16)10-12-5-8(6-13-10)9(11)14/h3-7H,1-2H3,(H2,11,14)/b4-3+/t7-/m0/s1 |
| InChIKey | GEEQTULRGDNRHE-SDLBARTOSA-N |
| XLogP | 0.24 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide?
The IUPAC name of 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide (CID 171458820) is 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide.
What is the SMILES notation for 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide?
The canonical SMILES for 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide is C[C@@H](/C=C/S(C)(=O)=O)c1ncc(C(N)=O)cn1.
What is the InChIKey of 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide?
The InChIKey is GEEQTULRGDNRHE-SDLBARTOSA-N. The full InChI is InChI=1S/C10H13N3O3S/c1-7(3-4-17(2,15)16)10-12-5-8(6-13-10)9(11)14/h3-7H,1-2H3,(H2,11,14)/b4-3+/t7-/m0/s1.
What are the key properties of 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide?
2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide has a molecular weight of 255.30 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,2S)-4-methylsulfonylbut-3-en-2-yl]pyrimidine-5-carboxamide is sourced from PubChem (CID 171458820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).