C31H24FN2O+ — CID 171459026
11-(1-fluorocarbazol-9-yl)-3,4,6,16-tetramethyl-8-oxa-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 171459026) has the molecular formula C31H24FN2O+ and a molecular weight of 459.54 g/mol. Its IUPAC name is 11-(1-fluorocarbazol-9-yl)-3,4,6,16-tetramethyl-8-oxa-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 11-(1-fluorocarbazol-9-yl)-3,4,6,16-tetramethyl-8-oxa-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 171459026 |
| Molecular Formula | C31H24FN2O+ |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 11-(1-fluorocarbazol-9-yl)-3,4,6,16-tetramethyl-8-oxa-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | Cc1cc(C)c2c(c1C)-c1c3c(cc(-n4c5ccccc5c5cccc(F)c54)cc3cc[n+]1C)O2 |
| InChI | InChI=1S/C31H24FN2O/c1-17-14-18(2)31-27(19(17)3)30-28-20(12-13-33(30)4)15-21(16-26(28)35-31)34-25-11-6-5-8-22(25)23-9-7-10-24(32)29(23)34/h5-16H,1-4H3/q+1 |
| InChIKey | RXNFOCNDDHEUCA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|