C34H34F3N7O4SSi — CID 171459642
N-[2,4-difluoro-3-[[6-[4-(hydroxymethyl)benzimidazol-1-yl]pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-fluoro-2-methyl-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide (PubChem CID 171459642) has the molecular formula C34H34F3N7O4SSi and a molecular weight of 721.84 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[[6-[4-(hydroxymethyl)benzimidazol-1-yl]pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-fluoro-2-methyl-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide.
| Compound Name | N-[2,4-difluoro-3-[[6-[4-(hydroxymethyl)benzimidazol-1-yl]pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-fluoro-2-methyl-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171459642 |
| Molecular Formula | C34H34F3N7O4SSi |
| Molecular Weight | 721.84 g/mol |
| Exact Mass | 721.21 |
| IUPAC Name | N-[2,4-difluoro-3-[[6-[4-(hydroxymethyl)benzimidazol-1-yl]pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-fluoro-2-methyl-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide |
| SMILES | Cc1c(F)cccc1S(=O)(=O)N(COCC[Si](C)(C)C)c1ccc(F)c(Nc2ncnc3ccc(-n4cnc5c(CO)cccc54)nc23)c1F |
| InChI | InChI=1S/C34H34F3N7O4SSi/c1-21-23(35)8-6-10-28(21)49(46,47)44(20-48-15-16-50(2,3)4)26-13-11-24(36)32(30(26)37)42-34-33-25(38-18-39-34)12-14-29(41-33)43-19-40-31-22(17-45)7-5-9-27(31)43/h5-14,18-19,45H,15-17,20H2,1-4H3,(H,38,39,42) |
| InChIKey | XLYJWNCMWRDEBR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.84 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|