C44H28N4 — CID 171459977
3-[6-[3-(4-phenylphenyl)-5-quinolin-8-ylphenyl]-3-pyridinyl]-1,10-phenanthroline (PubChem CID 171459977) has the molecular formula C44H28N4 and a molecular weight of 612.74 g/mol. Its IUPAC name is 3-[6-[3-(4-phenylphenyl)-5-quinolin-8-ylphenyl]-3-pyridinyl]-1,10-phenanthroline.
| Compound Name | 3-[6-[3-(4-phenylphenyl)-5-quinolin-8-ylphenyl]-3-pyridinyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 171459977 |
| Molecular Formula | C44H28N4 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 3-[6-[3-(4-phenylphenyl)-5-quinolin-8-ylphenyl]-3-pyridinyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5cnc6c(ccc7cccnc76)c5)cn4)cc(-c4cccc5cccnc45)c3)cc2)cc1 |
| InChI | InChI=1S/C44H28N4/c1-2-7-29(8-3-1)30-13-15-31(16-14-30)36-24-37(40-12-4-9-32-10-5-21-45-42(32)40)26-38(25-36)41-20-19-35(27-47-41)39-23-34-18-17-33-11-6-22-46-43(33)44(34)48-28-39/h1-28H |
| InChIKey | LDWXYURUOQICBK-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|